C39H74N2O5 — CID 54253409
12-hydroxy-N-[2-hydroxy-3-(12-hydroxyoctadec-9-enoylamino)propyl]octadec-9-enamide (PubChem CID 54253409) has the molecular formula C39H74N2O5 and a molecular weight of 651.03 g/mol. Its IUPAC name is 12-hydroxy-N-[2-hydroxy-3-(12-hydroxyoctadec-9-enoylamino)propyl]octadec-9-enamide.
| Compound Name | 12-hydroxy-N-[2-hydroxy-3-(12-hydroxyoctadec-9-enoylamino)propyl]octadec-9-enamide |
|---|---|
| PubChem CID | 54253409 |
| Molecular Formula | C39H74N2O5 |
| Molecular Weight | 651.03 g/mol |
| Exact Mass | 650.56 |
| IUPAC Name | 12-hydroxy-N-[2-hydroxy-3-(12-hydroxyoctadec-9-enoylamino)propyl]octadec-9-enamide |
| SMILES | CCCCCCC(O)CC=CCCCCCCCC(=O)NCC(O)CNC(=O)CCCCCCCC=CCC(O)CCCCCC |
| InChI | InChI=1S/C39H74N2O5/c1-3-5-7-21-27-35(42)29-23-17-13-9-11-15-19-25-31-38(45)40-33-37(44)34-41-39(46)32-26-20-16-12-10-14-18-24-30-36(43)28-22-8-6-4-2/h17-18,23-24,35-37,42-44H,3-16,19-22,25-34H2,1-2H3,(H,40,45)(H,41,46) |
| InChIKey | QYIUDUWLDXCCMZ-UHFFFAOYSA-N |
| XLogP | 8.60 |
| TPSA | 118.89 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.03 |
| LogP ≤ 5 | 8.60 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|