C21H41NO3 — CID 54105430
(12R)-12-hydroxy-N-(2-hydroxypropyl)octadec-9-enamide (PubChem CID 54105430) has the molecular formula C21H41NO3 and a molecular weight of 355.56 g/mol. Its IUPAC name is (12R)-12-hydroxy-N-(2-hydroxypropyl)octadec-9-enamide.
| Compound Name | (12R)-12-hydroxy-N-(2-hydroxypropyl)octadec-9-enamide |
|---|---|
| PubChem CID | 54105430 |
| Molecular Formula | C21H41NO3 |
| Molecular Weight | 355.56 g/mol |
| Exact Mass | 355.31 |
| IUPAC Name | (12R)-12-hydroxy-N-(2-hydroxypropyl)octadec-9-enamide |
| SMILES | CCCCCC[C@@H](O)CC=CCCCCCCCC(=O)NCC(C)O |
| InChI | InChI=1S/C21H41NO3/c1-3-4-5-12-15-20(24)16-13-10-8-6-7-9-11-14-17-21(25)22-18-19(2)23/h10,13,19-20,23-24H,3-9,11-12,14-18H2,1-2H3,(H,22,25)/t19?,20-/m1/s1 |
| InChIKey | NDKLZRHLYBMXNO-GFOWMXPYSA-N |
| XLogP | 4.49 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.56 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|