C24H46N2O4 — CID 76514668
N,N'-bis(2-hydroxypropyl)octadec-9-enediamide (PubChem CID 76514668) has the molecular formula C24H46N2O4 and a molecular weight of 426.64 g/mol. Its IUPAC name is N,N'-bis(2-hydroxypropyl)octadec-9-enediamide.
| Compound Name | N,N'-bis(2-hydroxypropyl)octadec-9-enediamide |
|---|---|
| PubChem CID | 76514668 |
| Molecular Formula | C24H46N2O4 |
| Molecular Weight | 426.64 g/mol |
| Exact Mass | 426.35 |
| IUPAC Name | N,N'-bis(2-hydroxypropyl)octadec-9-enediamide |
| SMILES | CC(O)CNC(=O)CCCCCCCC=CCCCCCCCC(=O)NCC(C)O |
| InChI | InChI=1S/C24H46N2O4/c1-21(27)19-25-23(29)17-15-13-11-9-7-5-3-4-6-8-10-12-14-16-18-24(30)26-20-22(2)28/h3-4,21-22,27-28H,5-20H2,1-2H3,(H,25,29)(H,26,30) |
| InChIKey | ZSLNJTNYGHVEBB-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.64 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|