C8H15NO2 — CID 83031292
N-[(2R)-2-hydroxypropyl]pent-4-enamide (PubChem CID 83031292) has the molecular formula C8H15NO2 and a molecular weight of 157.21 g/mol. Its IUPAC name is N-[(2R)-2-hydroxypropyl]pent-4-enamide.
| Compound Name | N-[(2R)-2-hydroxypropyl]pent-4-enamide |
|---|---|
| PubChem CID | 83031292 |
| Molecular Formula | C8H15NO2 |
| Molecular Weight | 157.21 g/mol |
| Exact Mass | 157.11 |
| IUPAC Name | N-[(2R)-2-hydroxypropyl]pent-4-enamide |
| SMILES | C=CCCC(=O)NC[C@@H](C)O |
| InChI | InChI=1S/C8H15NO2/c1-3-4-5-8(11)9-6-7(2)10/h3,7,10H,1,4-6H2,2H3,(H,9,11)/t7-/m1/s1 |
| InChIKey | BEHTZDCATNGWGP-SSDOTTSWSA-N |
| XLogP | 0.45 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.21 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|