C16H26Cl2N2O — CID 119526644
N-[2-amino-2-(4-propan-2-ylphenyl)ethyl]pent-4-enamide;dihydrochloride (PubChem CID 119526644) has the molecular formula C16H26Cl2N2O and a molecular weight of 333.30 g/mol. Its IUPAC name is N-[2-amino-2-(4-propan-2-ylphenyl)ethyl]pent-4-enamide;dihydrochloride.
| Compound Name | N-[2-amino-2-(4-propan-2-ylphenyl)ethyl]pent-4-enamide;dihydrochloride |
|---|---|
| PubChem CID | 119526644 |
| Molecular Formula | C16H26Cl2N2O |
| Molecular Weight | 333.30 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | N-[2-amino-2-(4-propan-2-ylphenyl)ethyl]pent-4-enamide;dihydrochloride |
| SMILES | C=CCCC(=O)NCC(N)c1ccc(C(C)C)cc1.Cl.Cl |
| InChI | InChI=1S/C16H24N2O.2ClH/c1-4-5-6-16(19)18-11-15(17)14-9-7-13(8-10-14)12(2)3;;/h4,7-10,12,15H,1,5-6,11,17H2,2-3H3,(H,18,19);2*1H |
| InChIKey | SZTKLPPVMUOUFI-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.30 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|