C18H31N3O — CID 122080402
7-amino-N-[2-amino-2-(4-propan-2-ylphenyl)ethyl]heptanamide (PubChem CID 122080402) has the molecular formula C18H31N3O and a molecular weight of 305.47 g/mol. Its IUPAC name is 7-amino-N-[2-amino-2-(4-propan-2-ylphenyl)ethyl]heptanamide.
| Compound Name | 7-amino-N-[2-amino-2-(4-propan-2-ylphenyl)ethyl]heptanamide |
|---|---|
| PubChem CID | 122080402 |
| Molecular Formula | C18H31N3O |
| Molecular Weight | 305.47 g/mol |
| Exact Mass | 305.25 |
| IUPAC Name | 7-amino-N-[2-amino-2-(4-propan-2-ylphenyl)ethyl]heptanamide |
| SMILES | CC(C)c1ccc(C(N)CNC(=O)CCCCCCN)cc1 |
| InChI | InChI=1S/C18H31N3O/c1-14(2)15-8-10-16(11-9-15)17(20)13-21-18(22)7-5-3-4-6-12-19/h8-11,14,17H,3-7,12-13,19-20H2,1-2H3,(H,21,22) |
| InChIKey | UCUAOSUVVHFBNF-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.47 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|