C17H28Cl2N2O — CID 119527050
N-[2-amino-2-(4-propan-2-ylphenyl)ethyl]hex-5-enamide;dihydrochloride (PubChem CID 119527050) has the molecular formula C17H28Cl2N2O and a molecular weight of 347.33 g/mol. Its IUPAC name is N-[2-amino-2-(4-propan-2-ylphenyl)ethyl]hex-5-enamide;dihydrochloride.
| Compound Name | N-[2-amino-2-(4-propan-2-ylphenyl)ethyl]hex-5-enamide;dihydrochloride |
|---|---|
| PubChem CID | 119527050 |
| Molecular Formula | C17H28Cl2N2O |
| Molecular Weight | 347.33 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | N-[2-amino-2-(4-propan-2-ylphenyl)ethyl]hex-5-enamide;dihydrochloride |
| SMILES | C=CCCCC(=O)NCC(N)c1ccc(C(C)C)cc1.Cl.Cl |
| InChI | InChI=1S/C17H26N2O.2ClH/c1-4-5-6-7-17(20)19-12-16(18)15-10-8-14(9-11-15)13(2)3;;/h4,8-11,13,16H,1,5-7,12,18H2,2-3H3,(H,19,20);2*1H |
| InChIKey | SBCWSYFOFXJNPR-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.33 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|