C7H14N2O4 — CID 86244799
N'-hydroxy-N-(2-hydroxypropyl)butanediamide (PubChem CID 86244799) has the molecular formula C7H14N2O4 and a molecular weight of 190.20 g/mol. Its IUPAC name is N'-hydroxy-N-(2-hydroxypropyl)butanediamide.
| Compound Name | N'-hydroxy-N-(2-hydroxypropyl)butanediamide |
|---|---|
| PubChem CID | 86244799 |
| Molecular Formula | C7H14N2O4 |
| Molecular Weight | 190.20 g/mol |
| Exact Mass | 190.10 |
| IUPAC Name | N'-hydroxy-N-(2-hydroxypropyl)butanediamide |
| SMILES | CC(O)CNC(=O)CCC(=O)NO |
| InChI | InChI=1S/C7H14N2O4/c1-5(10)4-8-6(11)2-3-7(12)9-13/h5,10,13H,2-4H2,1H3,(H,8,11)(H,9,12) |
| InChIKey | LBEVWVUNBYRSCE-UHFFFAOYSA-N |
| XLogP | -1.23 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.20 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|