C5H12N2O3 — CID 142100619
N-hydroxy-2-(2-hydroxypropylamino)acetamide (PubChem CID 142100619) has the molecular formula C5H12N2O3 and a molecular weight of 148.16 g/mol. Its IUPAC name is N-hydroxy-2-(2-hydroxypropylamino)acetamide.
| Compound Name | N-hydroxy-2-(2-hydroxypropylamino)acetamide |
|---|---|
| PubChem CID | 142100619 |
| Molecular Formula | C5H12N2O3 |
| Molecular Weight | 148.16 g/mol |
| Exact Mass | 148.08 |
| IUPAC Name | N-hydroxy-2-(2-hydroxypropylamino)acetamide |
| SMILES | CC(O)CNCC(=O)NO |
| InChI | InChI=1S/C5H12N2O3/c1-4(8)2-6-3-5(9)7-10/h4,6,8,10H,2-3H2,1H3,(H,7,9) |
| InChIKey | SJGQTGNUWNBKPB-UHFFFAOYSA-N |
| XLogP | -1.54 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.16 |
| LogP ≤ 5 | -1.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|