C7H14N2O3 — CID 156750692
2-(2-hydroxypropylamino)-N-(2-oxoethyl)acetamide (PubChem CID 156750692) has the molecular formula C7H14N2O3 and a molecular weight of 174.20 g/mol. Its IUPAC name is 2-(2-hydroxypropylamino)-N-(2-oxoethyl)acetamide.
| Compound Name | 2-(2-hydroxypropylamino)-N-(2-oxoethyl)acetamide |
|---|---|
| PubChem CID | 156750692 |
| Molecular Formula | C7H14N2O3 |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.10 |
| IUPAC Name | 2-(2-hydroxypropylamino)-N-(2-oxoethyl)acetamide |
| SMILES | CC(O)CNCC(=O)NCC=O |
| InChI | InChI=1S/C7H14N2O3/c1-6(11)4-8-5-7(12)9-2-3-10/h3,6,8,11H,2,4-5H2,1H3,(H,9,12) |
| InChIKey | VCZWXABXYUUXGI-UHFFFAOYSA-N |
| XLogP | -1.73 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | -1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|