C6H9ClN2O3 — CID 173312497
2-[(2-chloroacetyl)amino]-N-(2-oxoethyl)acetamide (PubChem CID 173312497) has the molecular formula C6H9ClN2O3 and a molecular weight of 192.60 g/mol. Its IUPAC name is 2-[(2-chloroacetyl)amino]-N-(2-oxoethyl)acetamide.
| Compound Name | 2-[(2-chloroacetyl)amino]-N-(2-oxoethyl)acetamide |
|---|---|
| PubChem CID | 173312497 |
| Molecular Formula | C6H9ClN2O3 |
| Molecular Weight | 192.60 g/mol |
| Exact Mass | 192.03 |
| IUPAC Name | 2-[(2-chloroacetyl)amino]-N-(2-oxoethyl)acetamide |
| SMILES | O=CCNC(=O)CNC(=O)CCl |
| InChI | InChI=1S/C6H9ClN2O3/c7-3-5(11)9-4-6(12)8-1-2-10/h2H,1,3-4H2,(H,8,12)(H,9,11) |
| InChIKey | KZIZOJVJGWEDLQ-UHFFFAOYSA-N |
| XLogP | -1.34 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.60 |
| LogP ≤ 5 | -1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|