C24H22N4O5 — CID 155030185
4-(2-azatricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaen-9-yn-2-yl)-4-oxo-N-[2-oxo-2-[[2-oxo-2-(2-oxoethylamino)ethyl]amino]ethyl]butanamide (PubChem CID 155030185) has the molecular formula C24H22N4O5 and a molecular weight of 446.46 g/mol. Its IUPAC name is 4-(2-azatricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaen-9-yn-2-yl)-4-oxo-N-[2-oxo-2-[[2-oxo-2-(2-oxoethylamino)ethyl]amino]ethyl]butanamide.
| Compound Name | 4-(2-azatricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaen-9-yn-2-yl)-4-oxo-N-[2-oxo-2-[[2-oxo-2-(2-oxoethylamino)ethyl]amino]ethyl]butanamide |
|---|---|
| PubChem CID | 155030185 |
| Molecular Formula | C24H22N4O5 |
| Molecular Weight | 446.46 g/mol |
| Exact Mass | 446.16 |
| IUPAC Name | 4-(2-azatricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaen-9-yn-2-yl)-4-oxo-N-[2-oxo-2-[[2-oxo-2-(2-oxoethylamino)ethyl]amino]ethyl]butanamide |
| SMILES | O=CCNC(=O)CNC(=O)CNC(=O)CCC(=O)N1c2ccccc2C#Cc2ccccc21 |
| InChI | InChI=1S/C24H22N4O5/c29-14-13-25-22(31)15-27-23(32)16-26-21(30)11-12-24(33)28-19-7-3-1-5-17(19)9-10-18-6-2-4-8-20(18)28/h1-8,14H,11-13,15-16H2,(H,25,31)(H,26,30)(H,27,32) |
| InChIKey | CNGSZCAGNMVNMF-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 124.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.46 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|