C29H38N2O4 — CID 134241691
4-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,8,12,14-pentaen-10-yn-2-yl)-N-[2-[2-(3,3-dimethylbutoxy)ethoxy]ethyl]-4-oxobutanamide (PubChem CID 134241691) has the molecular formula C29H38N2O4 and a molecular weight of 478.63 g/mol. Its IUPAC name is 4-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,8,12,14-pentaen-10-yn-2-yl)-N-[2-[2-(3,3-dimethylbutoxy)ethoxy]ethyl]-4-oxobutanamide.
| Compound Name | 4-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,8,12,14-pentaen-10-yn-2-yl)-N-[2-[2-(3,3-dimethylbutoxy)ethoxy]ethyl]-4-oxobutanamide |
|---|---|
| PubChem CID | 134241691 |
| Molecular Formula | C29H38N2O4 |
| Molecular Weight | 478.63 g/mol |
| Exact Mass | 478.28 |
| IUPAC Name | 4-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,8,12,14-pentaen-10-yn-2-yl)-N-[2-[2-(3,3-dimethylbutoxy)ethoxy]ethyl]-4-oxobutanamide |
| SMILES | CC(C)(C)CCOCCOCCNC(=O)CCC(=O)N1CC2=CCCC=C2C#Cc2ccccc21 |
| InChI | InChI=1S/C29H38N2O4/c1-29(2,3)16-18-34-20-21-35-19-17-30-27(32)14-15-28(33)31-22-25-10-5-4-8-23(25)12-13-24-9-6-7-11-26(24)31/h6-11H,4-5,14-22H2,1-3H3,(H,30,32) |
| InChIKey | HAOOFSAYMZZBAY-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.63 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|