C35H49N3O8Si — CID 176519005
4-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-4-oxo-N-[2-[2-[3-oxo-3-(3-triethoxysilylpropylamino)propoxy]ethoxy]ethyl]butanamide (PubChem CID 176519005) has the molecular formula C35H49N3O8Si and a molecular weight of 667.88 g/mol. Its IUPAC name is 4-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-4-oxo-N-[2-[2-[3-oxo-3-(3-triethoxysilylpropylamino)propoxy]ethoxy]ethyl]butanamide.
| Compound Name | 4-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-4-oxo-N-[2-[2-[3-oxo-3-(3-triethoxysilylpropylamino)propoxy]ethoxy]ethyl]butanamide |
|---|---|
| PubChem CID | 176519005 |
| Molecular Formula | C35H49N3O8Si |
| Molecular Weight | 667.88 g/mol |
| Exact Mass | 667.33 |
| IUPAC Name | 4-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-4-oxo-N-[2-[2-[3-oxo-3-(3-triethoxysilylpropylamino)propoxy]ethoxy]ethyl]butanamide |
| SMILES | CCO[Si](CCCNC(=O)CCOCCOCCNC(=O)CCC(=O)N1Cc2ccccc2C#Cc2ccccc21)(OCC)OCC |
| InChI | InChI=1S/C35H49N3O8Si/c1-4-44-47(45-5-2,46-6-3)27-11-21-36-34(40)20-23-42-25-26-43-24-22-37-33(39)18-19-35(41)38-28-31-14-8-7-12-29(31)16-17-30-13-9-10-15-32(30)38/h7-10,12-15H,4-6,11,18-28H2,1-3H3,(H,36,40)(H,37,39) |
| InChIKey | KEDMZMTTZSRSCN-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 124.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.88 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|