C35H46N4O8 — CID 121451477
(2S)-2-[3-[2-[2-[2-[2-[[4-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-4-oxobutanoyl]amino]ethoxy]ethoxy]ethoxy]ethoxy]propanoylamino]-3-methylbutanamide (PubChem CID 121451477) has the molecular formula C35H46N4O8 and a molecular weight of 650.77 g/mol. Its IUPAC name is (2S)-2-[3-[2-[2-[2-[2-[[4-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-4-oxobutanoyl]amino]ethoxy]ethoxy]ethoxy]ethoxy]propanoylamino]-3-methylbutanamide.
| Compound Name | (2S)-2-[3-[2-[2-[2-[2-[[4-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-4-oxobutanoyl]amino]ethoxy]ethoxy]ethoxy]ethoxy]propanoylamino]-3-methylbutanamide |
|---|---|
| PubChem CID | 121451477 |
| Molecular Formula | C35H46N4O8 |
| Molecular Weight | 650.77 g/mol |
| Exact Mass | 650.33 |
| IUPAC Name | (2S)-2-[3-[2-[2-[2-[2-[[4-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-4-oxobutanoyl]amino]ethoxy]ethoxy]ethoxy]ethoxy]propanoylamino]-3-methylbutanamide |
| SMILES | CC(C)[C@H](NC(=O)CCOCCOCCOCCOCCNC(=O)CCC(=O)N1Cc2ccccc2C#Cc2ccccc21)C(N)=O |
| InChI | InChI=1S/C35H46N4O8/c1-26(2)34(35(36)43)38-32(41)15-17-44-19-21-46-23-24-47-22-20-45-18-16-37-31(40)13-14-33(42)39-25-29-9-4-3-7-27(29)11-12-28-8-5-6-10-30(28)39/h3-10,26,34H,13-25H2,1-2H3,(H2,36,43)(H,37,40)(H,38,41)/t34-/m0/s1 |
| InChIKey | GWMXXOQSKMAKIZ-UMSFTDKQSA-N |
| XLogP | 1.91 |
| TPSA | 158.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.77 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|