C34H48N4O7Si — CID 156598823
6-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-6-oxo-N-[2-[2-(2-triethoxysilylethylcarbamoylamino)ethoxy]ethyl]hexanamide (PubChem CID 156598823) has the molecular formula C34H48N4O7Si and a molecular weight of 652.87 g/mol. Its IUPAC name is 6-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-6-oxo-N-[2-[2-(2-triethoxysilylethylcarbamoylamino)ethoxy]ethyl]hexanamide.
| Compound Name | 6-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-6-oxo-N-[2-[2-(2-triethoxysilylethylcarbamoylamino)ethoxy]ethyl]hexanamide |
|---|---|
| PubChem CID | 156598823 |
| Molecular Formula | C34H48N4O7Si |
| Molecular Weight | 652.87 g/mol |
| Exact Mass | 652.33 |
| IUPAC Name | 6-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-6-oxo-N-[2-[2-(2-triethoxysilylethylcarbamoylamino)ethoxy]ethyl]hexanamide |
| SMILES | CCO[Si](CCNC(=O)NCCOCCNC(=O)CCCCC(=O)N1Cc2ccccc2C#Cc2ccccc21)(OCC)OCC |
| InChI | InChI=1S/C34H48N4O7Si/c1-4-43-46(44-5-2,45-6-3)26-23-37-34(41)36-22-25-42-24-21-35-32(39)17-11-12-18-33(40)38-27-30-15-8-7-13-28(30)19-20-29-14-9-10-16-31(29)38/h7-10,13-16H,4-6,11-12,17-18,21-27H2,1-3H3,(H,35,39)(H2,36,37,41) |
| InChIKey | UXXSHVWDIQRUAG-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 127.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.87 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|