C30H31N3O7 — CID 167312686
(2,5-dioxopyrrolidin-1-yl) 3-[2-[[6-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-6-oxohexanoyl]amino]ethoxy]propanoate (PubChem CID 167312686) has the molecular formula C30H31N3O7 and a molecular weight of 545.59 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 3-[2-[[6-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-6-oxohexanoyl]amino]ethoxy]propanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 3-[2-[[6-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-6-oxohexanoyl]amino]ethoxy]propanoate |
|---|---|
| PubChem CID | 167312686 |
| Molecular Formula | C30H31N3O7 |
| Molecular Weight | 545.59 g/mol |
| Exact Mass | 545.22 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 3-[2-[[6-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-6-oxohexanoyl]amino]ethoxy]propanoate |
| SMILES | O=C(CCCCC(=O)N1Cc2ccccc2C#Cc2ccccc21)NCCOCCC(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C30H31N3O7/c34-26(31-18-20-39-19-17-30(38)40-33-28(36)15-16-29(33)37)11-5-6-12-27(35)32-21-24-9-2-1-7-22(24)13-14-23-8-3-4-10-25(23)32/h1-4,7-10H,5-6,11-12,15-21H2,(H,31,34) |
| InChIKey | CKDBGOHIELUBEE-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 122.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.59 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|