C11H17ClN2O6 — CID 15053734
diethyl 2-[[2-[(2-chloroacetyl)amino]acetyl]amino]propanedioate (PubChem CID 15053734) has the molecular formula C11H17ClN2O6 and a molecular weight of 308.72 g/mol. Its IUPAC name is diethyl 2-[[2-[(2-chloroacetyl)amino]acetyl]amino]propanedioate.
| Compound Name | diethyl 2-[[2-[(2-chloroacetyl)amino]acetyl]amino]propanedioate |
|---|---|
| PubChem CID | 15053734 |
| Molecular Formula | C11H17ClN2O6 |
| Molecular Weight | 308.72 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | diethyl 2-[[2-[(2-chloroacetyl)amino]acetyl]amino]propanedioate |
| SMILES | CCOC(=O)C(NC(=O)CNC(=O)CCl)C(=O)OCC |
| InChI | InChI=1S/C11H17ClN2O6/c1-3-19-10(17)9(11(18)20-4-2)14-8(16)6-13-7(15)5-12/h9H,3-6H2,1-2H3,(H,13,15)(H,14,16) |
| InChIKey | HXEGYATTXWNGPS-UHFFFAOYSA-N |
| XLogP | -1.05 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.72 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|