C8H16ClNO3 — CID 12663166
2-chloro-N-(2,2-diethoxyethyl)acetamide (PubChem CID 12663166) has the molecular formula C8H16ClNO3 and a molecular weight of 209.67 g/mol. Its IUPAC name is 2-chloro-N-(2,2-diethoxyethyl)acetamide.
| Compound Name | 2-chloro-N-(2,2-diethoxyethyl)acetamide |
|---|---|
| PubChem CID | 12663166 |
| Molecular Formula | C8H16ClNO3 |
| Molecular Weight | 209.67 g/mol |
| Exact Mass | 209.08 |
| IUPAC Name | 2-chloro-N-(2,2-diethoxyethyl)acetamide |
| SMILES | CCOC(CNC(=O)CCl)OCC |
| InChI | InChI=1S/C8H16ClNO3/c1-3-12-8(13-4-2)6-10-7(11)5-9/h8H,3-6H2,1-2H3,(H,10,11) |
| InChIKey | PDFYDALWSHJVAT-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.67 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|