C12H23NO5 — CID 79548215
5-(2,2-diethoxyethylamino)-3-methyl-5-oxopentanoic acid (PubChem CID 79548215) has the molecular formula C12H23NO5 and a molecular weight of 261.32 g/mol. Its IUPAC name is 5-(2,2-diethoxyethylamino)-3-methyl-5-oxopentanoic acid.
| Compound Name | 5-(2,2-diethoxyethylamino)-3-methyl-5-oxopentanoic acid |
|---|---|
| PubChem CID | 79548215 |
| Molecular Formula | C12H23NO5 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.16 |
| IUPAC Name | 5-(2,2-diethoxyethylamino)-3-methyl-5-oxopentanoic acid |
| SMILES | CCOC(CNC(=O)CC(C)CC(=O)O)OCC |
| InChI | InChI=1S/C12H23NO5/c1-4-17-12(18-5-2)8-13-10(14)6-9(3)7-11(15)16/h9,12H,4-8H2,1-3H3,(H,13,14)(H,15,16) |
| InChIKey | ZDDMZEFHFPZXPW-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|