C17H34N2O6 — CID 141334867
N,N'-bis(2,2-diethoxyethyl)pentanediamide (PubChem CID 141334867) has the molecular formula C17H34N2O6 and a molecular weight of 362.47 g/mol. Its IUPAC name is N,N'-bis(2,2-diethoxyethyl)pentanediamide.
| Compound Name | N,N'-bis(2,2-diethoxyethyl)pentanediamide |
|---|---|
| PubChem CID | 141334867 |
| Molecular Formula | C17H34N2O6 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.24 |
| IUPAC Name | N,N'-bis(2,2-diethoxyethyl)pentanediamide |
| SMILES | CCOC(CNC(=O)CCCC(=O)NCC(OCC)OCC)OCC |
| InChI | InChI=1S/C17H34N2O6/c1-5-22-16(23-6-2)12-18-14(20)10-9-11-15(21)19-13-17(24-7-3)25-8-4/h16-17H,5-13H2,1-4H3,(H,18,20)(H,19,21) |
| InChIKey | BCYXDBHYNNEOFO-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|