C10H21NO3 — CID 79548415
N-(2,2-diethoxyethyl)butanamide (PubChem CID 79548415) has the molecular formula C10H21NO3 and a molecular weight of 203.28 g/mol. Its IUPAC name is N-(2,2-diethoxyethyl)butanamide.
| Compound Name | N-(2,2-diethoxyethyl)butanamide |
|---|---|
| PubChem CID | 79548415 |
| Molecular Formula | C10H21NO3 |
| Molecular Weight | 203.28 g/mol |
| Exact Mass | 203.15 |
| IUPAC Name | N-(2,2-diethoxyethyl)butanamide |
| SMILES | CCCC(=O)NCC(OCC)OCC |
| InChI | InChI=1S/C10H21NO3/c1-4-7-9(12)11-8-10(13-5-2)14-6-3/h10H,4-8H2,1-3H3,(H,11,12) |
| InChIKey | UUNZUCVGORXWPG-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.28 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|