5-(2,2-dimethoxyethylamino)-3-methyl-5-oxopentanoic acid

C10H19NO5 — CID 62965063

IUPAC5-(2,2-dimethoxyethylamino)-3-methyl-5-oxopentanoic acid
SMILESCOC(CNC(=O)CC(C)CC(=O)O)OC
InChIInChI=1S/C10H19NO5/c1-7(5-9(13)14)4-8(12)11-6-10(15-2)16-3/h7,10H,4-6H2,1-3H3,(H,11,12)(H,13,14)
InChIKeyRDRBHALLROGQLO-UHFFFAOYSA-N
MW233.26 g/mol
LogP0.22
Rot. Bonds8

About 5-(2,2-dimethoxyethylamino)-3-methyl-5-oxopentanoic acid

5-(2,2-dimethoxyethylamino)-3-methyl-5-oxopentanoic acid (PubChem CID 62965063) has the molecular formula C10H19NO5 and a molecular weight of 233.26 g/mol. Its IUPAC name is 5-(2,2-dimethoxyethylamino)-3-methyl-5-oxopentanoic acid.

Molecular Properties

Compound Name5-(2,2-dimethoxyethylamino)-3-methyl-5-oxopentanoic acid
PubChem CID62965063
Molecular FormulaC10H19NO5
Molecular Weight233.26 g/mol
Exact Mass233.13
IUPAC Name5-(2,2-dimethoxyethylamino)-3-methyl-5-oxopentanoic acid
SMILESCOC(CNC(=O)CC(C)CC(=O)O)OC
InChIInChI=1S/C10H19NO5/c1-7(5-9(13)14)4-8(12)11-6-10(15-2)16-3/h7,10H,4-6H2,1-3H3,(H,11,12)(H,13,14)
InChIKeyRDRBHALLROGQLO-UHFFFAOYSA-N
XLogP0.22
TPSA84.86 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds8
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500233.26
LogP ≤ 50.22
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}

Analyze 5-(2,2-dimethoxyethylamino)-3-methyl-5-oxopentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-(2,2-dimethoxyethylamino)-3-methyl-5-oxopentanoic acid?
The IUPAC name of 5-(2,2-dimethoxyethylamino)-3-methyl-5-oxopentanoic acid (CID 62965063) is 5-(2,2-dimethoxyethylamino)-3-methyl-5-oxopentanoic acid.
What is the SMILES notation for 5-(2,2-dimethoxyethylamino)-3-methyl-5-oxopentanoic acid?
The canonical SMILES for 5-(2,2-dimethoxyethylamino)-3-methyl-5-oxopentanoic acid is COC(CNC(=O)CC(C)CC(=O)O)OC.
What is the InChIKey of 5-(2,2-dimethoxyethylamino)-3-methyl-5-oxopentanoic acid?
The InChIKey is RDRBHALLROGQLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19NO5/c1-7(5-9(13)14)4-8(12)11-6-10(15-2)16-3/h7,10H,4-6H2,1-3H3,(H,11,12)(H,13,14).
What are the key properties of 5-(2,2-dimethoxyethylamino)-3-methyl-5-oxopentanoic acid?
5-(2,2-dimethoxyethylamino)-3-methyl-5-oxopentanoic acid has a molecular weight of 233.26 g/mol, XLogP of 0.22, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2,2-dimethoxyethylamino)-3-methyl-5-oxopentanoic acid is sourced from PubChem (CID 62965063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).