C8H16N2O5 — CID 64896338
3-amino-4-(2,2-dimethoxyethylamino)-4-oxobutanoic acid (PubChem CID 64896338) has the molecular formula C8H16N2O5 and a molecular weight of 220.22 g/mol. Its IUPAC name is 3-amino-4-(2,2-dimethoxyethylamino)-4-oxobutanoic acid.
| Compound Name | 3-amino-4-(2,2-dimethoxyethylamino)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 64896338 |
| Molecular Formula | C8H16N2O5 |
| Molecular Weight | 220.22 g/mol |
| Exact Mass | 220.11 |
| IUPAC Name | 3-amino-4-(2,2-dimethoxyethylamino)-4-oxobutanoic acid |
| SMILES | COC(CNC(=O)C(N)CC(=O)O)OC |
| InChI | InChI=1S/C8H16N2O5/c1-14-7(15-2)4-10-8(13)5(9)3-6(11)12/h5,7H,3-4,9H2,1-2H3,(H,10,13)(H,11,12) |
| InChIKey | NCLOJXIACULMNK-UHFFFAOYSA-N |
| XLogP | -1.48 |
| TPSA | 110.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.22 |
| LogP ≤ 5 | -1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|