C9H18N2O5 — CID 103157306
4-[(2-amino-3-methoxypropanoyl)amino]-3-methoxybutanoic acid (PubChem CID 103157306) has the molecular formula C9H18N2O5 and a molecular weight of 234.25 g/mol. Its IUPAC name is 4-[(2-amino-3-methoxypropanoyl)amino]-3-methoxybutanoic acid.
| Compound Name | 4-[(2-amino-3-methoxypropanoyl)amino]-3-methoxybutanoic acid |
|---|---|
| PubChem CID | 103157306 |
| Molecular Formula | C9H18N2O5 |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.12 |
| IUPAC Name | 4-[(2-amino-3-methoxypropanoyl)amino]-3-methoxybutanoic acid |
| SMILES | COCC(N)C(=O)NCC(CC(=O)O)OC |
| InChI | InChI=1S/C9H18N2O5/c1-15-5-7(10)9(14)11-4-6(16-2)3-8(12)13/h6-7H,3-5,10H2,1-2H3,(H,11,14)(H,12,13) |
| InChIKey | XHNWMTBHHNRDAF-UHFFFAOYSA-N |
| XLogP | -1.43 |
| TPSA | 110.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | -1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |