C9H20N2O3 — CID 61274915
2-amino-N-(2,2-dimethoxyethyl)pentanamide (PubChem CID 61274915) has the molecular formula C9H20N2O3 and a molecular weight of 204.27 g/mol. Its IUPAC name is 2-amino-N-(2,2-dimethoxyethyl)pentanamide.
| Compound Name | 2-amino-N-(2,2-dimethoxyethyl)pentanamide |
|---|---|
| PubChem CID | 61274915 |
| Molecular Formula | C9H20N2O3 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.15 |
| IUPAC Name | 2-amino-N-(2,2-dimethoxyethyl)pentanamide |
| SMILES | CCCC(N)C(=O)NCC(OC)OC |
| InChI | InChI=1S/C9H20N2O3/c1-4-5-7(10)9(12)11-6-8(13-2)14-3/h7-8H,4-6,10H2,1-3H3,(H,11,12) |
| InChIKey | FZLSZWVDOORFOC-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|