C7H16N2O3 — CID 78973572
(2R)-2-amino-N-(2,2-dimethoxyethyl)propanamide (PubChem CID 78973572) has the molecular formula C7H16N2O3 and a molecular weight of 176.22 g/mol. Its IUPAC name is (2R)-2-amino-N-(2,2-dimethoxyethyl)propanamide.
| Compound Name | (2R)-2-amino-N-(2,2-dimethoxyethyl)propanamide |
|---|---|
| PubChem CID | 78973572 |
| Molecular Formula | C7H16N2O3 |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.12 |
| IUPAC Name | (2R)-2-amino-N-(2,2-dimethoxyethyl)propanamide |
| SMILES | COC(CNC(=O)[C@@H](C)N)OC |
| InChI | InChI=1S/C7H16N2O3/c1-5(8)7(10)9-4-6(11-2)12-3/h5-6H,4,8H2,1-3H3,(H,9,10)/t5-/m1/s1 |
| InChIKey | FWAGZQARCSXGKA-RXMQYKEDSA-N |
| XLogP | -0.93 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|