C8H17NO4 — CID 21075732
3,3-diethoxypropylcarbamic acid (PubChem CID 21075732) has the molecular formula C8H17NO4 and a molecular weight of 191.23 g/mol. Its IUPAC name is 3,3-diethoxypropylcarbamic acid.
| Compound Name | 3,3-diethoxypropylcarbamic acid |
|---|---|
| PubChem CID | 21075732 |
| Molecular Formula | C8H17NO4 |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.12 |
| IUPAC Name | 3,3-diethoxypropylcarbamic acid |
| SMILES | CCOC(CCNC(=O)O)OCC |
| InChI | InChI=1S/C8H17NO4/c1-3-12-7(13-4-2)5-6-9-8(10)11/h7,9H,3-6H2,1-2H3,(H,10,11) |
| InChIKey | MMFHMVSAIRRYEH-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|