About 3,3-diethoxypropylcarbamic acid
3,3-diethoxypropylcarbamic acid (PubChem CID 21075732) has the molecular formula C8H17NO4
and a molecular weight of 191.23 g/mol. Its IUPAC name is 3,3-diethoxypropylcarbamic acid.
Molecular Properties
| Compound Name | 3,3-diethoxypropylcarbamic acid |
| PubChem CID | 21075732 |
| Molecular Formula | C8H17NO4 |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.12 |
| IUPAC Name | 3,3-diethoxypropylcarbamic acid |
| SMILES | CCOC(CCNC(=O)O)OCC |
| InChI | InChI=1S/C8H17NO4/c1-3-12-7(13-4-2)5-6-9-8(10)11/h7,9H,3-6H2,1-2H3,(H,10,11) |
| InChIKey | MMFHMVSAIRRYEH-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 3,3-diethoxypropylcarbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-diethoxypropylcarbamic acid?
The IUPAC name of 3,3-diethoxypropylcarbamic acid (CID 21075732) is 3,3-diethoxypropylcarbamic acid.
What is the SMILES notation for 3,3-diethoxypropylcarbamic acid?
The canonical SMILES for 3,3-diethoxypropylcarbamic acid is CCOC(CCNC(=O)O)OCC.
What is the InChIKey of 3,3-diethoxypropylcarbamic acid?
The InChIKey is MMFHMVSAIRRYEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17NO4/c1-3-12-7(13-4-2)5-6-9-8(10)11/h7,9H,3-6H2,1-2H3,(H,10,11).
What are the key properties of 3,3-diethoxypropylcarbamic acid?
3,3-diethoxypropylcarbamic acid has a molecular weight of 191.23 g/mol, XLogP of 1.04, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-diethoxypropylcarbamic acid is sourced from PubChem (CID 21075732), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).