C13H28N2O3 — CID 113406943
2-(3,3-diethoxypropylamino)-N-propan-2-ylpropanamide (PubChem CID 113406943) has the molecular formula C13H28N2O3 and a molecular weight of 260.38 g/mol. Its IUPAC name is 2-(3,3-diethoxypropylamino)-N-propan-2-ylpropanamide.
| Compound Name | 2-(3,3-diethoxypropylamino)-N-propan-2-ylpropanamide |
|---|---|
| PubChem CID | 113406943 |
| Molecular Formula | C13H28N2O3 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.21 |
| IUPAC Name | 2-(3,3-diethoxypropylamino)-N-propan-2-ylpropanamide |
| SMILES | CCOC(CCNC(C)C(=O)NC(C)C)OCC |
| InChI | InChI=1S/C13H28N2O3/c1-6-17-12(18-7-2)8-9-14-11(5)13(16)15-10(3)4/h10-12,14H,6-9H2,1-5H3,(H,15,16) |
| InChIKey | BSPARJUYPBFBAS-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|