C10H22N2O3 — CID 81095052
2-(3,3-diethoxypropylamino)propanamide (PubChem CID 81095052) has the molecular formula C10H22N2O3 and a molecular weight of 218.30 g/mol. Its IUPAC name is 2-(3,3-diethoxypropylamino)propanamide.
| Compound Name | 2-(3,3-diethoxypropylamino)propanamide |
|---|---|
| PubChem CID | 81095052 |
| Molecular Formula | C10H22N2O3 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.16 |
| IUPAC Name | 2-(3,3-diethoxypropylamino)propanamide |
| SMILES | CCOC(CCNC(C)C(N)=O)OCC |
| InChI | InChI=1S/C10H22N2O3/c1-4-14-9(15-5-2)6-7-12-8(3)10(11)13/h8-9,12H,4-7H2,1-3H3,(H2,11,13) |
| InChIKey | JFOSDZSREFRCJS-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|