C11H25NO4S — CID 81092736
3,3-diethoxy-N-(1-methylsulfonylpropan-2-yl)propan-1-amine (PubChem CID 81092736) has the molecular formula C11H25NO4S and a molecular weight of 267.39 g/mol. Its IUPAC name is 3,3-diethoxy-N-(1-methylsulfonylpropan-2-yl)propan-1-amine.
| Compound Name | 3,3-diethoxy-N-(1-methylsulfonylpropan-2-yl)propan-1-amine |
|---|---|
| PubChem CID | 81092736 |
| Molecular Formula | C11H25NO4S |
| Molecular Weight | 267.39 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | 3,3-diethoxy-N-(1-methylsulfonylpropan-2-yl)propan-1-amine |
| SMILES | CCOC(CCNC(C)CS(C)(=O)=O)OCC |
| InChI | InChI=1S/C11H25NO4S/c1-5-15-11(16-6-2)7-8-12-10(3)9-17(4,13)14/h10-12H,5-9H2,1-4H3 |
| InChIKey | YRYJTMHHQODUHC-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.39 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|