C9H20N2O4S — CID 115901299
ethyl N-[2-(1-methylsulfonylpropan-2-ylamino)ethyl]carbamate (PubChem CID 115901299) has the molecular formula C9H20N2O4S and a molecular weight of 252.34 g/mol. Its IUPAC name is ethyl N-[2-(1-methylsulfonylpropan-2-ylamino)ethyl]carbamate.
| Compound Name | ethyl N-[2-(1-methylsulfonylpropan-2-ylamino)ethyl]carbamate |
|---|---|
| PubChem CID | 115901299 |
| Molecular Formula | C9H20N2O4S |
| Molecular Weight | 252.34 g/mol |
| Exact Mass | 252.11 |
| IUPAC Name | ethyl N-[2-(1-methylsulfonylpropan-2-ylamino)ethyl]carbamate |
| SMILES | CCOC(=O)NCCNC(C)CS(C)(=O)=O |
| InChI | InChI=1S/C9H20N2O4S/c1-4-15-9(12)11-6-5-10-8(2)7-16(3,13)14/h8,10H,4-7H2,1-3H3,(H,11,12) |
| InChIKey | XFWHMQPVRBHKEL-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.34 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|