C11H22N2O5S — CID 97029196
ethyl N-[2-[[(2R)-2-propan-2-ylsulfonylpropanoyl]amino]ethyl]carbamate (PubChem CID 97029196) has the molecular formula C11H22N2O5S and a molecular weight of 294.37 g/mol. Its IUPAC name is ethyl N-[2-[[(2R)-2-propan-2-ylsulfonylpropanoyl]amino]ethyl]carbamate.
| Compound Name | ethyl N-[2-[[(2R)-2-propan-2-ylsulfonylpropanoyl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 97029196 |
| Molecular Formula | C11H22N2O5S |
| Molecular Weight | 294.37 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | ethyl N-[2-[[(2R)-2-propan-2-ylsulfonylpropanoyl]amino]ethyl]carbamate |
| SMILES | CCOC(=O)NCCNC(=O)[C@@H](C)S(=O)(=O)C(C)C |
| InChI | InChI=1S/C11H22N2O5S/c1-5-18-11(15)13-7-6-12-10(14)9(4)19(16,17)8(2)3/h8-9H,5-7H2,1-4H3,(H,12,14)(H,13,15)/t9-/m1/s1 |
| InChIKey | ZKIWLDAYTSMWFE-SECBINFHSA-N |
| XLogP | 0.06 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.37 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|