C10H21N3O3 — CID 108867369
ethyl N-[2-(2-methylpropylcarbamoylamino)ethyl]carbamate (PubChem CID 108867369) has the molecular formula C10H21N3O3 and a molecular weight of 231.30 g/mol. Its IUPAC name is ethyl N-[2-(2-methylpropylcarbamoylamino)ethyl]carbamate.
| Compound Name | ethyl N-[2-(2-methylpropylcarbamoylamino)ethyl]carbamate |
|---|---|
| PubChem CID | 108867369 |
| Molecular Formula | C10H21N3O3 |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.16 |
| IUPAC Name | ethyl N-[2-(2-methylpropylcarbamoylamino)ethyl]carbamate |
| SMILES | CCOC(=O)NCCNC(=O)NCC(C)C |
| InChI | InChI=1S/C10H21N3O3/c1-4-16-10(15)12-6-5-11-9(14)13-7-8(2)3/h8H,4-7H2,1-3H3,(H,12,15)(H2,11,13,14) |
| InChIKey | LCVSVZRLCSFIND-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|