C17H35NO4 — CID 59537059
2,3,4-trimethylhexyl N-(3,3-diethoxypropyl)carbamate (PubChem CID 59537059) has the molecular formula C17H35NO4 and a molecular weight of 317.47 g/mol. Its IUPAC name is 2,3,4-trimethylhexyl N-(3,3-diethoxypropyl)carbamate.
| Compound Name | 2,3,4-trimethylhexyl N-(3,3-diethoxypropyl)carbamate |
|---|---|
| PubChem CID | 59537059 |
| Molecular Formula | C17H35NO4 |
| Molecular Weight | 317.47 g/mol |
| Exact Mass | 317.26 |
| IUPAC Name | 2,3,4-trimethylhexyl N-(3,3-diethoxypropyl)carbamate |
| SMILES | CCOC(CCNC(=O)OCC(C)C(C)C(C)CC)OCC |
| InChI | InChI=1S/C17H35NO4/c1-7-13(4)15(6)14(5)12-22-17(19)18-11-10-16(20-8-2)21-9-3/h13-16H,7-12H2,1-6H3,(H,18,19) |
| InChIKey | KJTARVCRILFHCP-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.47 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|