C19H44N2O5Si2 — CID 175706755
1,3-bis(5,5-diethoxy-3-silylpentyl)urea (PubChem CID 175706755) has the molecular formula C19H44N2O5Si2 and a molecular weight of 436.74 g/mol. Its IUPAC name is 1,3-bis(5,5-diethoxy-3-silylpentyl)urea.
| Compound Name | 1,3-bis(5,5-diethoxy-3-silylpentyl)urea |
|---|---|
| PubChem CID | 175706755 |
| Molecular Formula | C19H44N2O5Si2 |
| Molecular Weight | 436.74 g/mol |
| Exact Mass | 436.28 |
| IUPAC Name | 1,3-bis(5,5-diethoxy-3-silylpentyl)urea |
| SMILES | CCOC(CC([SiH3])CCNC(=O)NCCC([SiH3])CC(OCC)OCC)OCC |
| InChI | InChI=1S/C19H44N2O5Si2/c1-5-23-17(24-6-2)13-15(27)9-11-20-19(22)21-12-10-16(28)14-18(25-7-3)26-8-4/h15-18H,5-14H2,1-4,27-28H3,(H2,20,21,22) |
| InChIKey | WMCCRQSBOBUEIY-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 78.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.74 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|