C15H17Cl2NO5 — CID 17435918
diethyl 2-[[2-(2,6-dichlorophenyl)acetyl]amino]propanedioate (PubChem CID 17435918) has the molecular formula C15H17Cl2NO5 and a molecular weight of 362.21 g/mol. Its IUPAC name is diethyl 2-[[2-(2,6-dichlorophenyl)acetyl]amino]propanedioate.
| Compound Name | diethyl 2-[[2-(2,6-dichlorophenyl)acetyl]amino]propanedioate |
|---|---|
| PubChem CID | 17435918 |
| Molecular Formula | C15H17Cl2NO5 |
| Molecular Weight | 362.21 g/mol |
| Exact Mass | 361.05 |
| IUPAC Name | diethyl 2-[[2-(2,6-dichlorophenyl)acetyl]amino]propanedioate |
| SMILES | CCOC(=O)C(NC(=O)Cc1c(Cl)cccc1Cl)C(=O)OCC |
| InChI | InChI=1S/C15H17Cl2NO5/c1-3-22-14(20)13(15(21)23-4-2)18-12(19)8-9-10(16)6-5-7-11(9)17/h5-7,13H,3-4,8H2,1-2H3,(H,18,19) |
| InChIKey | YGYLTNONXOJNSV-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.21 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|