C18H19Cl2NO — CID 7700454
2-(2,6-dichlorophenyl)-N-(2,6-diethylphenyl)acetamide (PubChem CID 7700454) has the molecular formula C18H19Cl2NO and a molecular weight of 336.26 g/mol. Its IUPAC name is 2-(2,6-dichlorophenyl)-N-(2,6-diethylphenyl)acetamide.
| Compound Name | 2-(2,6-dichlorophenyl)-N-(2,6-diethylphenyl)acetamide |
|---|---|
| PubChem CID | 7700454 |
| Molecular Formula | C18H19Cl2NO |
| Molecular Weight | 336.26 g/mol |
| Exact Mass | 335.08 |
| IUPAC Name | 2-(2,6-dichlorophenyl)-N-(2,6-diethylphenyl)acetamide |
| SMILES | CCc1cccc(CC)c1NC(=O)Cc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C18H19Cl2NO/c1-3-12-7-5-8-13(4-2)18(12)21-17(22)11-14-15(19)9-6-10-16(14)20/h5-10H,3-4,11H2,1-2H3,(H,21,22) |
| InChIKey | KHVZHSCPQQBNJZ-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.26 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |