C13H12Cl2N2O2 — CID 51098104
2-(2,6-dichlorophenyl)-N-(3,5-dimethyl-1,2-oxazol-4-yl)acetamide (PubChem CID 51098104) has the molecular formula C13H12Cl2N2O2 and a molecular weight of 299.16 g/mol. Its IUPAC name is 2-(2,6-dichlorophenyl)-N-(3,5-dimethyl-1,2-oxazol-4-yl)acetamide.
| Compound Name | 2-(2,6-dichlorophenyl)-N-(3,5-dimethyl-1,2-oxazol-4-yl)acetamide |
|---|---|
| PubChem CID | 51098104 |
| Molecular Formula | C13H12Cl2N2O2 |
| Molecular Weight | 299.16 g/mol |
| Exact Mass | 298.03 |
| IUPAC Name | 2-(2,6-dichlorophenyl)-N-(3,5-dimethyl-1,2-oxazol-4-yl)acetamide |
| SMILES | Cc1noc(C)c1NC(=O)Cc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C13H12Cl2N2O2/c1-7-13(8(2)19-17-7)16-12(18)6-9-10(14)4-3-5-11(9)15/h3-5H,6H2,1-2H3,(H,16,18) |
| InChIKey | VICLADOFPGXXHU-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.16 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |