C14H16ClN3O2 — CID 56825450
1-[1-(2-chlorophenyl)ethyl]-3-(3,5-dimethyl-1,2-oxazol-4-yl)urea (PubChem CID 56825450) has the molecular formula C14H16ClN3O2 and a molecular weight of 293.75 g/mol. Its IUPAC name is 1-[1-(2-chlorophenyl)ethyl]-3-(3,5-dimethyl-1,2-oxazol-4-yl)urea.
| Compound Name | 1-[1-(2-chlorophenyl)ethyl]-3-(3,5-dimethyl-1,2-oxazol-4-yl)urea |
|---|---|
| PubChem CID | 56825450 |
| Molecular Formula | C14H16ClN3O2 |
| Molecular Weight | 293.75 g/mol |
| Exact Mass | 293.09 |
| IUPAC Name | 1-[1-(2-chlorophenyl)ethyl]-3-(3,5-dimethyl-1,2-oxazol-4-yl)urea |
| SMILES | Cc1noc(C)c1NC(=O)NC(C)c1ccccc1Cl |
| InChI | InChI=1S/C14H16ClN3O2/c1-8(11-6-4-5-7-12(11)15)16-14(19)17-13-9(2)18-20-10(13)3/h4-8H,1-3H3,(H2,16,17,19) |
| InChIKey | HJKZMQIYLPBZTL-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.75 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |