C18H13Cl2NO2 — CID 8797412
2-(2,6-dichlorophenyl)-N-(2-hydroxynaphthalen-1-yl)acetamide (PubChem CID 8797412) has the molecular formula C18H13Cl2NO2 and a molecular weight of 346.21 g/mol. Its IUPAC name is 2-(2,6-dichlorophenyl)-N-(2-hydroxynaphthalen-1-yl)acetamide.
| Compound Name | 2-(2,6-dichlorophenyl)-N-(2-hydroxynaphthalen-1-yl)acetamide |
|---|---|
| PubChem CID | 8797412 |
| Molecular Formula | C18H13Cl2NO2 |
| Molecular Weight | 346.21 g/mol |
| Exact Mass | 345.03 |
| IUPAC Name | 2-(2,6-dichlorophenyl)-N-(2-hydroxynaphthalen-1-yl)acetamide |
| SMILES | O=C(Cc1c(Cl)cccc1Cl)Nc1c(O)ccc2ccccc12 |
| InChI | InChI=1S/C18H13Cl2NO2/c19-14-6-3-7-15(20)13(14)10-17(23)21-18-12-5-2-1-4-11(12)8-9-16(18)22/h1-9,22H,10H2,(H,21,23) |
| InChIKey | YMTBSHKIKBGBJL-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.21 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|