C16H12Cl2N2O — CID 46587432
N-[(4-cyanophenyl)methyl]-2-(2,6-dichlorophenyl)acetamide (PubChem CID 46587432) has the molecular formula C16H12Cl2N2O and a molecular weight of 319.19 g/mol. Its IUPAC name is N-[(4-cyanophenyl)methyl]-2-(2,6-dichlorophenyl)acetamide.
| Compound Name | N-[(4-cyanophenyl)methyl]-2-(2,6-dichlorophenyl)acetamide |
|---|---|
| PubChem CID | 46587432 |
| Molecular Formula | C16H12Cl2N2O |
| Molecular Weight | 319.19 g/mol |
| Exact Mass | 318.03 |
| IUPAC Name | N-[(4-cyanophenyl)methyl]-2-(2,6-dichlorophenyl)acetamide |
| SMILES | N#Cc1ccc(CNC(=O)Cc2c(Cl)cccc2Cl)cc1 |
| InChI | InChI=1S/C16H12Cl2N2O/c17-14-2-1-3-15(18)13(14)8-16(21)20-10-12-6-4-11(9-19)5-7-12/h1-7H,8,10H2,(H,20,21) |
| InChIKey | QNIAMCLHDOPDJU-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.19 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |