C14H9Cl2N3O — CID 60736617
3,6-dichloro-N-[(4-cyanophenyl)methyl]pyridine-2-carboxamide (PubChem CID 60736617) has the molecular formula C14H9Cl2N3O and a molecular weight of 306.15 g/mol. Its IUPAC name is 3,6-dichloro-N-[(4-cyanophenyl)methyl]pyridine-2-carboxamide.
| Compound Name | 3,6-dichloro-N-[(4-cyanophenyl)methyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 60736617 |
| Molecular Formula | C14H9Cl2N3O |
| Molecular Weight | 306.15 g/mol |
| Exact Mass | 305.01 |
| IUPAC Name | 3,6-dichloro-N-[(4-cyanophenyl)methyl]pyridine-2-carboxamide |
| SMILES | N#Cc1ccc(CNC(=O)c2nc(Cl)ccc2Cl)cc1 |
| InChI | InChI=1S/C14H9Cl2N3O/c15-11-5-6-12(16)19-13(11)14(20)18-8-10-3-1-9(7-17)2-4-10/h1-6H,8H2,(H,18,20) |
| InChIKey | YQTLRIRJEJGMTQ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.15 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|