C9H7Cl2N3O — CID 60693634
3,6-dichloro-N-(2-cyanoethyl)pyridine-2-carboxamide (PubChem CID 60693634) has the molecular formula C9H7Cl2N3O and a molecular weight of 244.08 g/mol. Its IUPAC name is 3,6-dichloro-N-(2-cyanoethyl)pyridine-2-carboxamide.
| Compound Name | 3,6-dichloro-N-(2-cyanoethyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 60693634 |
| Molecular Formula | C9H7Cl2N3O |
| Molecular Weight | 244.08 g/mol |
| Exact Mass | 243.00 |
| IUPAC Name | 3,6-dichloro-N-(2-cyanoethyl)pyridine-2-carboxamide |
| SMILES | N#CCCNC(=O)c1nc(Cl)ccc1Cl |
| InChI | InChI=1S/C9H7Cl2N3O/c10-6-2-3-7(11)14-8(6)9(15)13-5-1-4-12/h2-3H,1,5H2,(H,13,15) |
| InChIKey | KMFWDTJPFYLGLS-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.08 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|