C9H8Cl2N2O — CID 26643522
3,6-dichloro-N-prop-2-enylpyridine-2-carboxamide (PubChem CID 26643522) has the molecular formula C9H8Cl2N2O and a molecular weight of 231.08 g/mol. Its IUPAC name is 3,6-dichloro-N-prop-2-enylpyridine-2-carboxamide.
| Compound Name | 3,6-dichloro-N-prop-2-enylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 26643522 |
| Molecular Formula | C9H8Cl2N2O |
| Molecular Weight | 231.08 g/mol |
| Exact Mass | 230.00 |
| IUPAC Name | 3,6-dichloro-N-prop-2-enylpyridine-2-carboxamide |
| SMILES | C=CCNC(=O)c1nc(Cl)ccc1Cl |
| InChI | InChI=1S/C9H8Cl2N2O/c1-2-5-12-9(14)8-6(10)3-4-7(11)13-8/h2-4H,1,5H2,(H,12,14) |
| InChIKey | UJMPSTYTLQLRSW-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.08 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|