C6H5Cl2N3O — CID 45278328
3,6-dichloropyridine-2-carbohydrazide (PubChem CID 45278328) has the molecular formula C6H5Cl2N3O and a molecular weight of 206.03 g/mol. Its IUPAC name is 3,6-dichloropyridine-2-carbohydrazide.
| Compound Name | 3,6-dichloropyridine-2-carbohydrazide |
|---|---|
| PubChem CID | 45278328 |
| Molecular Formula | C6H5Cl2N3O |
| Molecular Weight | 206.03 g/mol |
| Exact Mass | 204.98 |
| IUPAC Name | 3,6-dichloropyridine-2-carbohydrazide |
| SMILES | NNC(=O)c1nc(Cl)ccc1Cl |
| InChI | InChI=1S/C6H5Cl2N3O/c7-3-1-2-4(8)10-5(3)6(12)11-9/h1-2H,9H2,(H,11,12) |
| InChIKey | FGBOJFXITSZYAA-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.03 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|