C11H14Cl2N2O2 — CID 79249197
3,6-dichloro-N-(1-hydroxy-3-methylbutan-2-yl)pyridine-2-carboxamide (PubChem CID 79249197) has the molecular formula C11H14Cl2N2O2 and a molecular weight of 277.15 g/mol. Its IUPAC name is 3,6-dichloro-N-(1-hydroxy-3-methylbutan-2-yl)pyridine-2-carboxamide.
| Compound Name | 3,6-dichloro-N-(1-hydroxy-3-methylbutan-2-yl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 79249197 |
| Molecular Formula | C11H14Cl2N2O2 |
| Molecular Weight | 277.15 g/mol |
| Exact Mass | 276.04 |
| IUPAC Name | 3,6-dichloro-N-(1-hydroxy-3-methylbutan-2-yl)pyridine-2-carboxamide |
| SMILES | CC(C)C(CO)NC(=O)c1nc(Cl)ccc1Cl |
| InChI | InChI=1S/C11H14Cl2N2O2/c1-6(2)8(5-16)14-11(17)10-7(12)3-4-9(13)15-10/h3-4,6,8,16H,5H2,1-2H3,(H,14,17) |
| InChIKey | BGULYWDOQRZLOY-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.15 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|