C13H20ClN3O2 — CID 79249652
5-chloro-N-[(2S)-1-hydroxy-3-methylbutan-2-yl]-2-propan-2-ylpyrimidine-4-carboxamide (PubChem CID 79249652) has the molecular formula C13H20ClN3O2 and a molecular weight of 285.78 g/mol. Its IUPAC name is 5-chloro-N-[(2S)-1-hydroxy-3-methylbutan-2-yl]-2-propan-2-ylpyrimidine-4-carboxamide.
| Compound Name | 5-chloro-N-[(2S)-1-hydroxy-3-methylbutan-2-yl]-2-propan-2-ylpyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 79249652 |
| Molecular Formula | C13H20ClN3O2 |
| Molecular Weight | 285.78 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | 5-chloro-N-[(2S)-1-hydroxy-3-methylbutan-2-yl]-2-propan-2-ylpyrimidine-4-carboxamide |
| SMILES | CC(C)c1ncc(Cl)c(C(=O)N[C@H](CO)C(C)C)n1 |
| InChI | InChI=1S/C13H20ClN3O2/c1-7(2)10(6-18)16-13(19)11-9(14)5-15-12(17-11)8(3)4/h5,7-8,10,18H,6H2,1-4H3,(H,16,19)/t10-/m1/s1 |
| InChIKey | BEGRRVWZYHRGHU-SNVBAGLBSA-N |
| XLogP | 2.00 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.78 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |