C11H12Cl2N2O3S — CID 103602658
2-[(3,6-dichloropyridine-2-carbonyl)amino]-4-methylsulfanylbutanoic acid (PubChem CID 103602658) has the molecular formula C11H12Cl2N2O3S and a molecular weight of 323.20 g/mol. Its IUPAC name is 2-[(3,6-dichloropyridine-2-carbonyl)amino]-4-methylsulfanylbutanoic acid.
| Compound Name | 2-[(3,6-dichloropyridine-2-carbonyl)amino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 103602658 |
| Molecular Formula | C11H12Cl2N2O3S |
| Molecular Weight | 323.20 g/mol |
| Exact Mass | 321.99 |
| IUPAC Name | 2-[(3,6-dichloropyridine-2-carbonyl)amino]-4-methylsulfanylbutanoic acid |
| SMILES | CSCCC(NC(=O)c1nc(Cl)ccc1Cl)C(=O)O |
| InChI | InChI=1S/C11H12Cl2N2O3S/c1-19-5-4-7(11(17)18)14-10(16)9-6(12)2-3-8(13)15-9/h2-3,7H,4-5H2,1H3,(H,14,16)(H,17,18) |
| InChIKey | UWWSQKDNGRLFGV-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.20 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|