C12H15ClN2O3S — CID 114036564
(2S)-2-[(4-chloro-6-methylpyridine-3-carbonyl)amino]-4-methylsulfanylbutanoic acid (PubChem CID 114036564) has the molecular formula C12H15ClN2O3S and a molecular weight of 302.78 g/mol. Its IUPAC name is (2S)-2-[(4-chloro-6-methylpyridine-3-carbonyl)amino]-4-methylsulfanylbutanoic acid.
| Compound Name | (2S)-2-[(4-chloro-6-methylpyridine-3-carbonyl)amino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 114036564 |
| Molecular Formula | C12H15ClN2O3S |
| Molecular Weight | 302.78 g/mol |
| Exact Mass | 302.05 |
| IUPAC Name | (2S)-2-[(4-chloro-6-methylpyridine-3-carbonyl)amino]-4-methylsulfanylbutanoic acid |
| SMILES | CSCC[C@H](NC(=O)c1cnc(C)cc1Cl)C(=O)O |
| InChI | InChI=1S/C12H15ClN2O3S/c1-7-5-9(13)8(6-14-7)11(16)15-10(12(17)18)3-4-19-2/h5-6,10H,3-4H2,1-2H3,(H,15,16)(H,17,18)/t10-/m0/s1 |
| InChIKey | HMZNAMCDZMHJAN-JTQLQIEISA-N |
| XLogP | 1.98 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.78 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |